Difference between revisions of "SJ09960"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-EPINEPHRINE L-EPINEPHRINE] == * common-name: ** (r)-adrenaline * smiles: ** c[n+]cc(o)c1(c=cc...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RS-TETRAHYDROBENZYLISOQUINOLINE RS-TETRAHYDROBENZYLISOQUINOLINE] == * common-name: ** (r,s)-tet...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RS-TETRAHYDROBENZYLISOQUINOLINE RS-TETRAHYDROBENZYLISOQUINOLINE] == |
* common-name: | * common-name: | ||
− | ** (r)- | + | ** (r,s)-tetrahydrobenzylisoquinoline |
* smiles: | * smiles: | ||
− | ** c[n+] | + | ** c3(c=cc(cc1(c2(c(cc[n+]1)=cc=cc=2)))=cc=3) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** yrycifuzsumaay-uhfffaoysa-o |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 224.325 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[2.1.1.115-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=(r)- | + | {{#set: common-name=(r,s)-tetrahydrobenzylisoquinoline}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yrycifuzsumaay-uhfffaoysa-o}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=224.325}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite RS-TETRAHYDROBENZYLISOQUINOLINE
- common-name:
- (r,s)-tetrahydrobenzylisoquinoline
- smiles:
- c3(c=cc(cc1(c2(c(cc[n+]1)=cc=cc=2)))=cc=3)
- inchi-key:
- yrycifuzsumaay-uhfffaoysa-o
- molecular-weight:
- 224.325