Difference between revisions of "SJ09960"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4209 CPD-4209] == * common-name: ** n6-dimethylallyladenine * smiles: ** cc(c)=ccnc1(=nc=nc...")
(Created page with "Category:gene == Gene SJ20146 == * transcription-direction: ** negative * right-end-position: ** 18520 * left-end-position: ** 18057 * centisome-position: ** 8.514962...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4209 CPD-4209] ==
+
== Gene SJ20146 ==
* common-name:
+
* transcription-direction:
** n6-dimethylallyladenine
+
** negative
* smiles:
+
* right-end-position:
** cc(c)=ccnc1(=nc=nc2(nc=nc1=2))
+
** 18520
* inchi-key:
+
* left-end-position:
** hyvabzigrdekcd-uhfffaoysa-n
+
** 18057
* molecular-weight:
+
* centisome-position:
** 203.246
+
** 8.514962   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[1.5.99.12-RXN]]
+
* [[S.japonica_sterols_curated]]
* [[RXN-4315]]
+
== Reaction(s) associated ==
* [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]]
+
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
* [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]]
+
** Category: [[annotation]]
== Reaction(s) known to produce the compound ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[1.5.99.12-RXN]]
+
{{#set: transcription-direction=negative}}
* [[RXN-4313]]
+
{{#set: right-end-position=18520}}
* [[RXN-4313-CPD-4205/WATER//CPD-15318/CPD-4209.35.]]
+
{{#set: left-end-position=18057}}
* [[RXN-4313-CPD-4205/WATER//CPD-16551/CPD-4209.35.]]
+
{{#set: centisome-position=8.514962    }}
* [[RXN-4315]]
+
{{#set: organism associated=S.japonica_sterols_curated}}
* [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]]
+
{{#set: nb reaction associated=1}}
* [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=n6-dimethylallyladenine}}
 
{{#set: inchi-key=inchikey=hyvabzigrdekcd-uhfffaoysa-n}}
 
{{#set: molecular-weight=203.246}}
 

Revision as of 20:20, 18 December 2020

Gene SJ20146

  • transcription-direction:
    • negative
  • right-end-position:
    • 18520
  • left-end-position:
    • 18057
  • centisome-position:
    • 8.514962

Organism(s) associated with this gene

Reaction(s) associated