Difference between revisions of "SJ10001"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE INDOLE] == * common-name: ** indole * smiles: ** c2(c=cc1(=c(c=cn1)c=2)) * inchi-key: **...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5734-TETRAHYDROXYFLAVONE 5734-TETRAHYDROXYFLAVONE] == * common-name: ** luteolin * smiles: ** c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE INDOLE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5734-TETRAHYDROXYFLAVONE 5734-TETRAHYDROXYFLAVONE] ==
 
* common-name:
 
* common-name:
** indole
+
** luteolin
 
* smiles:
 
* smiles:
** c2(c=cc1(=c(c=cn1)c=2))
+
** c1(=c(c=c(o)c(o)=c1)c2(oc3(c=c([o-])c=c(o)c(c(=o)c=2)=3)))
 
* inchi-key:
 
* inchi-key:
** sikjaqjrhwyjai-uhfffaoysa-n
+
** iqpnaansbpbgfq-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 117.15
+
** 285.232
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[INDOLE-23-DIOXYGENASE-RXN]]
 
* [[RXN0-2381]]
 
* [[RXN0-2382]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-2381]]
+
* [[RXN-7651]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=indole}}
+
{{#set: common-name=luteolin}}
{{#set: inchi-key=inchikey=sikjaqjrhwyjai-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=iqpnaansbpbgfq-uhfffaoysa-m}}
{{#set: molecular-weight=117.15}}
+
{{#set: molecular-weight=285.232}}

Revision as of 09:23, 27 August 2019

Metabolite 5734-TETRAHYDROXYFLAVONE

  • common-name:
    • luteolin
  • smiles:
    • c1(=c(c=c(o)c(o)=c1)c2(oc3(c=c([o-])c=c(o)c(c(=o)c=2)=3)))
  • inchi-key:
    • iqpnaansbpbgfq-uhfffaoysa-m
  • molecular-weight:
    • 285.232

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality