Difference between revisions of "SJ10050"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-804 CPD-804] == * common-name: ** (4s)-4-hydroxy-2-oxoheptanedioate * smiles: ** c(ccc(o)cc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Trans-3-enoyl-CoAs Trans-3-enoyl-CoAs] == * common-name: ** a (3e)-alkan-3-enoyl-coa == Reactio...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-804 CPD-804] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Trans-3-enoyl-CoAs Trans-3-enoyl-CoAs] ==
 
* common-name:
 
* common-name:
** (4s)-4-hydroxy-2-oxoheptanedioate
+
** a (3e)-alkan-3-enoyl-coa
* smiles:
 
** c(ccc(o)cc(c([o-])=o)=o)([o-])=o
 
* inchi-key:
 
** hnoajoyerztsnk-bypyzucnsa-l
 
* molecular-weight:
 
** 188.137
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[4-HYDROXY-2-KETOPIMELATE-LYSIS-RXN]]
+
* [[RXN-7836]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-12521]]
 +
* [[RXN-7835]]
 +
* [[RXN-7836]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(4s)-4-hydroxy-2-oxoheptanedioate}}
+
{{#set: common-name=a (3e)-alkan-3-enoyl-coa}}
{{#set: inchi-key=inchikey=hnoajoyerztsnk-bypyzucnsa-l}}
 
{{#set: molecular-weight=188.137}}
 

Revision as of 09:24, 27 August 2019

Metabolite Trans-3-enoyl-CoAs

  • common-name:
    • a (3e)-alkan-3-enoyl-coa

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality