Difference between revisions of "SJ10116"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-TRYPTOPHAN D-TRYPTOPHAN] == * common-name: ** d-tryptophan * smiles: ** c2(nc1(c=cc=cc=1c(cc(...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8078 CPD-8078] == * common-name: ** 1-18:3-2-16:2-monogalactosyldiacylglycerol * smiles: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-TRYPTOPHAN D-TRYPTOPHAN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8078 CPD-8078] ==
 
* common-name:
 
* common-name:
** d-tryptophan
+
** 1-18:3-2-16:2-monogalactosyldiacylglycerol
 
* smiles:
 
* smiles:
** c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2))
+
** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=cccccc)=o)=o
 
* inchi-key:
 
* inchi-key:
** qivbcdijiajpqs-secbinfhsa-n
+
** wsmybuvbfwdmec-sbpcighssa-n
 
* molecular-weight:
 
* molecular-weight:
** 204.228
+
** 749.036
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8664]]
+
* [[RXN-8309]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-8299]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-tryptophan}}
+
{{#set: common-name=1-18:3-2-16:2-monogalactosyldiacylglycerol}}
{{#set: inchi-key=inchikey=qivbcdijiajpqs-secbinfhsa-n}}
+
{{#set: inchi-key=inchikey=wsmybuvbfwdmec-sbpcighssa-n}}
{{#set: molecular-weight=204.228}}
+
{{#set: molecular-weight=749.036}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-8078

  • common-name:
    • 1-18:3-2-16:2-monogalactosyldiacylglycerol
  • smiles:
    • ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=cccccc)=o)=o
  • inchi-key:
    • wsmybuvbfwdmec-sbpcighssa-n
  • molecular-weight:
    • 749.036

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality