Difference between revisions of "SJ10125"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17329 CPD-17329] == * common-name: ** 3-oxo-tetracosatetraenoyl-coa * smiles: ** cccccc=ccc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9460 CPD-9460] == * common-name: ** oleanolate 3 β-d-glucuronoside * smiles: ** cc6(cc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17329 CPD-17329] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9460 CPD-9460] ==
 
* common-name:
 
* common-name:
** 3-oxo-tetracosatetraenoyl-coa
+
** oleanolate 3 β-d-glucuronoside
 
* smiles:
 
* smiles:
** cccccc=ccc=ccc=ccc=ccccccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** cc6(ccc5(ccc1(c(=cc[ch]2(c1(cc[ch]3(c2(ccc(c3(c)c)oc4(c(c(c(c(o4)c(=o)[o-])o)o)o))c))c))[ch]5c6)c)c(=o)[o-])c
 
* inchi-key:
 
* inchi-key:
** wsalicwlarpulc-gjykhrjnsa-j
+
** iuchkmazawjnbj-rcyxvvtdsa-l
 
* molecular-weight:
 
* molecular-weight:
** 1120.05
+
** 630.817
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17109]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-9000]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-tetracosatetraenoyl-coa}}
+
{{#set: common-name=oleanolate 3 β-d-glucuronoside}}
{{#set: inchi-key=inchikey=wsalicwlarpulc-gjykhrjnsa-j}}
+
{{#set: inchi-key=inchikey=iuchkmazawjnbj-rcyxvvtdsa-l}}
{{#set: molecular-weight=1120.05}}
+
{{#set: molecular-weight=630.817}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-9460

  • common-name:
    • oleanolate 3 β-d-glucuronoside
  • smiles:
    • cc6(ccc5(ccc1(c(=cc[ch]2(c1(cc[ch]3(c2(ccc(c3(c)c)oc4(c(c(c(c(o4)c(=o)[o-])o)o)o))c))c))[ch]5c6)c)c(=o)[o-])c
  • inchi-key:
    • iuchkmazawjnbj-rcyxvvtdsa-l
  • molecular-weight:
    • 630.817

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality