Difference between revisions of "SJ10173"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYGUANOSINE DEOXYGUANOSINE] == * common-name: ** 2'-deoxyguanosine * smiles: ** c(o)c1(oc(cc...")
(Created page with "Category:gene == Gene SJ20435 == * transcription-direction: ** negative * right-end-position: ** 642232 * left-end-position: ** 627701 * centisome-position: ** 55.26933...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYGUANOSINE DEOXYGUANOSINE] ==
+
== Gene SJ20435 ==
* common-name:
+
* transcription-direction:
** 2'-deoxyguanosine
+
** negative
* smiles:
+
* right-end-position:
** c(o)c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
+
** 642232
* inchi-key:
+
* left-end-position:
** ykbgvtzyehremt-kvqbguixsa-n
+
** 627701
* molecular-weight:
+
* centisome-position:
** 267.244
+
** 55.26933   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[DEOXYGUANPHOSPHOR-RXN]]
+
* [[S.japonica_sterols_curated]]
* [[DMPH]]
+
== Reaction(s) associated ==
== Reaction(s) known to produce the compound ==
+
* [[PROTEIN-KINASE-RXN]]
* [[DEOXYGUANPHOSPHOR-RXN]]
+
** Category: [[annotation]]
* [[DGTPTRIPHYDRO-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[DMPH]]
+
** Category: [[orthology]]
== Reaction(s) of unknown directionality ==
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
{{#set: common-name=2'-deoxyguanosine}}
+
{{#set: transcription-direction=negative}}
{{#set: inchi-key=inchikey=ykbgvtzyehremt-kvqbguixsa-n}}
+
{{#set: right-end-position=642232}}
{{#set: molecular-weight=267.244}}
+
{{#set: left-end-position=627701}}
 +
{{#set: centisome-position=55.26933    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=1}}

Revision as of 20:21, 18 December 2020

Gene SJ20435

  • transcription-direction:
    • negative
  • right-end-position:
    • 642232
  • left-end-position:
    • 627701
  • centisome-position:
    • 55.26933

Organism(s) associated with this gene

Reaction(s) associated