Difference between revisions of "SJ10173"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-SEROTONIN N-ACETYL-SEROTONIN] == * common-name: ** n-acetyl-serotonin * smiles: ** cc(...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYGUANOSINE DEOXYGUANOSINE] == * common-name: ** 2'-deoxyguanosine * smiles: ** c(o)c1(oc(cc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYGUANOSINE DEOXYGUANOSINE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2'-deoxyguanosine |
* smiles: | * smiles: | ||
| − | ** cc( | + | ** c(o)c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ykbgvtzyehremt-kvqbguixsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 267.244 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[DEOXYGUANPHOSPHOR-RXN]] |
| − | * [[ | + | * [[DMPH]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[DEOXYGUANPHOSPHOR-RXN]] |
| + | * [[DGTPTRIPHYDRO-RXN]] | ||
| + | * [[DMPH]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2'-deoxyguanosine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ykbgvtzyehremt-kvqbguixsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=267.244}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite DEOXYGUANOSINE
- common-name:
- 2'-deoxyguanosine
- smiles:
- c(o)c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
- inchi-key:
- ykbgvtzyehremt-kvqbguixsa-n
- molecular-weight:
- 267.244
