Difference between revisions of "SJ10233"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4127 CPD-4127] == * common-name: ** isofucosterol * smiles: ** cc=c(c(c)c)ccc(c)[ch]3(cc[ch...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDMETA-13651 CPDMETA-13651] == * common-name: ** perakine * smiles: ** cc3(n5(c2(c1(=nc6(=cc=c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4127 CPD-4127] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDMETA-13651 CPDMETA-13651] ==
 
* common-name:
 
* common-name:
** isofucosterol
+
** perakine
 
* smiles:
 
* smiles:
** cc=c(c(c)c)ccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
+
** cc3(n5(c2(c1(=nc6(=cc=cc=c(c41(c(c(c(c2)c(c=o)3)c(c4)5)oc(=o)c))6)))))
 
* inchi-key:
 
* inchi-key:
** oselkochbmdkej-wgmizeqosa-n
+
** gdxjmogwonjrhl-vqhwpedhsa-n
 
* molecular-weight:
 
* molecular-weight:
** 412.698
+
** 350.416
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-12673]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-4210]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=isofucosterol}}
+
{{#set: common-name=perakine}}
{{#set: inchi-key=inchikey=oselkochbmdkej-wgmizeqosa-n}}
+
{{#set: inchi-key=inchikey=gdxjmogwonjrhl-vqhwpedhsa-n}}
{{#set: molecular-weight=412.698}}
+
{{#set: molecular-weight=350.416}}

Revision as of 14:20, 26 August 2019

Metabolite CPDMETA-13651

  • common-name:
    • perakine
  • smiles:
    • cc3(n5(c2(c1(=nc6(=cc=cc=c(c41(c(c(c(c2)c(c=o)3)c(c4)5)oc(=o)c))6)))))
  • inchi-key:
    • gdxjmogwonjrhl-vqhwpedhsa-n
  • molecular-weight:
    • 350.416

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality