Difference between revisions of "SJ10233"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORIBOSYL-CARBOXY-AMINOIMIDAZOLE PHOSPHORIBOSYL-CARBOXY-AMINOIMIDAZOLE] == * common-name:...")
(Created page with "Category:gene == Gene SJ00803 == * transcription-direction: ** positive * right-end-position: ** 66831 * left-end-position: ** 60221 * centisome-position: ** 10.775185...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORIBOSYL-CARBOXY-AMINOIMIDAZOLE PHOSPHORIBOSYL-CARBOXY-AMINOIMIDAZOLE] ==
+
== Gene SJ00803 ==
−
* common-name:
+
* transcription-direction:
−
** 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxylate
+
** positive
−
* smiles:
+
* right-end-position:
−
** c(op([o-])([o-])=o)c2(c(o)c(o)c(n1(c=nc(c([o-])=o)=c(n)1))o2)
+
** 66831
−
* inchi-key:
+
* left-end-position:
−
** xfvulmdjzxymsg-ziyngmlesa-k
+
** 60221
−
* molecular-weight:
+
* centisome-position:
−
** 336.174
+
** 10.775185   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[AIRCARBOXY-RXN]]
+
* [[S.japonica_sterols_curated]]
−
* [[SAICARSYN-RXN]]
+
== Reaction(s) associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[DNA-DIRECTED-DNA-POLYMERASE-RXN]]
−
* [[AIRCARBOXY-RXN]]
+
** Category: [[orthology]]
−
== Reaction(s) of unknown directionality ==
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
−
{{#set: common-name=5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxylate}}
+
* [[DNA-DIRECTED-RNA-POLYMERASE-RXN]]
−
{{#set: inchi-key=inchikey=xfvulmdjzxymsg-ziyngmlesa-k}}
+
** Category: [[annotation]]
−
{{#set: molecular-weight=336.174}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=66831}}
 +
{{#set: left-end-position=60221}}
 +
{{#set: centisome-position=10.775185    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=2}}

Revision as of 20:20, 18 December 2020

Gene SJ00803

  • transcription-direction:
    • positive
  • right-end-position:
    • 66831
  • left-end-position:
    • 60221
  • centisome-position:
    • 10.775185

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ10233&oldid=41219"