Difference between revisions of "SJ10355"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15364 CPD-15364] == * common-name: ** ricinoleoyl-coa * smiles: ** ccccccc(o)cc=ccccccccc(s...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2015 CPD0-2015] == * common-name: ** n-acetyl-l-methionine * smiles: ** cc(=o)nc(ccsc)c([o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15364 CPD-15364] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2015 CPD0-2015] ==
 
* common-name:
 
* common-name:
** ricinoleoyl-coa
+
** n-acetyl-l-methionine
 
* smiles:
 
* smiles:
** ccccccc(o)cc=ccccccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** cc(=o)nc(ccsc)c([o-])=o
 
* inchi-key:
 
* inchi-key:
** bhvzcckrrpyxcv-mgnvxpimsa-j
+
** xuypxlnmdzirqh-lurjtmiesa-m
 
* molecular-weight:
 
* molecular-weight:
** 1043.952
+
** 190.237
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14492]]
 
* [[RXN-16151]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16151]]
+
* [[RXN-17892]]
 +
* [[RXN-17893]]
 +
* [[RXN0-6948]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=ricinoleoyl-coa}}
+
{{#set: common-name=n-acetyl-l-methionine}}
{{#set: inchi-key=inchikey=bhvzcckrrpyxcv-mgnvxpimsa-j}}
+
{{#set: inchi-key=inchikey=xuypxlnmdzirqh-lurjtmiesa-m}}
{{#set: molecular-weight=1043.952}}
+
{{#set: molecular-weight=190.237}}

Revision as of 14:19, 26 August 2019

Metabolite CPD0-2015

  • common-name:
    • n-acetyl-l-methionine
  • smiles:
    • cc(=o)nc(ccsc)c([o-])=o
  • inchi-key:
    • xuypxlnmdzirqh-lurjtmiesa-m
  • molecular-weight:
    • 190.237

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality