Difference between revisions of "SJ10358"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THREO-DS-ISO-CITRATE THREO-DS-ISO-CITRATE] == * common-name: ** d-threo-isocitrate * smiles: **...")
 
(Created page with "Category:gene == Gene SJ10358 == * transcription-direction: ** positive * right-end-position: ** 460475 * left-end-position: ** 459567 * centisome-position: ** 56.80455...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THREO-DS-ISO-CITRATE THREO-DS-ISO-CITRATE] ==
+
== Gene SJ10358 ==
−
* common-name:
+
* transcription-direction:
−
** d-threo-isocitrate
+
** positive
−
* smiles:
+
* right-end-position:
−
** c(=o)(c(cc([o-])=o)c(o)c([o-])=o)[o-]
+
** 460475
−
* inchi-key:
+
* left-end-position:
−
** odblhexudapzau-zafykaaxsa-k
+
** 459567
−
* molecular-weight:
+
* centisome-position:
−
** 189.101
+
** 56.80455   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[ACONITATEHYDR-RXN]]
+
* [[S.japonica_carotenoid_curated]]
−
* [[ISOCIT-CLEAV-RXN]]
+
== Reaction(s) associated ==
−
* [[ISOCITDEH-RXN]]
+
* [[RXN-15559]]
−
* [[RXN-14047]]
+
** Category: [[annotation]]
−
* [[RXN-9951]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[biomass_rxn]]
+
* [[RXN-15560]]
−
== Reaction(s) known to produce the compound ==
+
** Category: [[annotation]]
−
* [[ACONITATEHYDR-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[ISOCIT-CLEAV-RXN]]
+
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
−
* [[ISOCITDEH-RXN]]
+
** Category: [[annotation]]
−
* [[RXN-14047]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[RXN-9951]]
+
== Pathway(s) associated ==
−
== Reaction(s) of unknown directionality ==
+
* [[PWY-7511]]
−
{{#set: common-name=d-threo-isocitrate}}
+
** '''7''' reactions found over '''9''' reactions in the full pathway
−
{{#set: inchi-key=inchikey=odblhexudapzau-zafykaaxsa-k}}
+
{{#set: transcription-direction=positive}}
−
{{#set: molecular-weight=189.101}}
+
{{#set: right-end-position=460475}}
 +
{{#set: left-end-position=459567}}
 +
{{#set: centisome-position=56.80455    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=3}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:03, 18 March 2021

Gene SJ10358

  • transcription-direction:
    • positive
  • right-end-position:
    • 460475
  • left-end-position:
    • 459567
  • centisome-position:
    • 56.80455

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-7511
    • 7 reactions found over 9 reactions in the full pathway




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ10358&oldid=132875"