Difference between revisions of "SJ10455"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8080 CPD-8080] == * common-name: ** 1-18:2-2-16:3-monogalactosyldiacylglycerol * smiles: **...")
(Created page with "Category:gene == Gene SJ10455 == * transcription-direction: ** negative * right-end-position: ** 320852 * left-end-position: ** 305000 * centisome-position: ** 78.03864...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8080 CPD-8080] ==
+
== Gene SJ10455 ==
* common-name:
+
* transcription-direction:
** 1-18:2-2-16:3-monogalactosyldiacylglycerol
+
** negative
* smiles:
+
* right-end-position:
** cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=ccc=ccc)=o)=o
+
** 320852
* inchi-key:
+
* left-end-position:
** dvrkgrmgqjlnpc-nidyupdjsa-n
+
** 305000
* molecular-weight:
+
* centisome-position:
** 749.036
+
** 78.03864   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-8301]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[RXN-8306]]
+
* [[METHIONINE--TRNA-LIGASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=1-18:2-2-16:3-monogalactosyldiacylglycerol}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=dvrkgrmgqjlnpc-nidyupdjsa-n}}
+
* [[RXN-16165]]
{{#set: molecular-weight=749.036}}
+
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[TRNA-CHARGING-PWY]]
 +
** '''21''' reactions found over '''21''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=320852}}
 +
{{#set: left-end-position=305000}}
 +
{{#set: centisome-position=78.03864    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:02, 18 March 2021

Gene SJ10455

  • transcription-direction:
    • negative
  • right-end-position:
    • 320852
  • left-end-position:
    • 305000
  • centisome-position:
    • 78.03864

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated