Difference between revisions of "SJ10493"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-P-SERINE 3-P-SERINE] == * common-name: ** 3-phospho-l-serine * smiles: ** c(op([o-])([o-])=o)...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Sulfur-Carrier-Proteins-ThiI Sulfur-Carrier-Proteins-ThiI] == * common-name: ** a [thii sulfur-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-P-SERINE 3-P-SERINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Sulfur-Carrier-Proteins-ThiI Sulfur-Carrier-Proteins-ThiI] ==
 
* common-name:
 
* common-name:
** 3-phospho-l-serine
+
** a [thii sulfur-carrier protein]-l-cysteine
* smiles:
 
** c(op([o-])([o-])=o)c([n+])c(=o)[o-]
 
* inchi-key:
 
** bzqfbwgglxlepq-reohclbhsa-l
 
* molecular-weight:
 
** 183.057
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PSERTRANSAM-RXN]]
+
* [[RXN-14382]]
* [[RXN0-5114]]
+
* [[RXN-9787]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PSERTRANSAM-RXN]]
+
* [[RXN-9787]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-phospho-l-serine}}
+
{{#set: common-name=a [thii sulfur-carrier protein]-l-cysteine}}
{{#set: inchi-key=inchikey=bzqfbwgglxlepq-reohclbhsa-l}}
 
{{#set: molecular-weight=183.057}}
 

Revision as of 09:24, 27 August 2019

Metabolite Sulfur-Carrier-Proteins-ThiI

  • common-name:
    • a [thii sulfur-carrier protein]-l-cysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [thii sulfur-carrier protein]-l-cysteine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.