Difference between revisions of "SJ10555"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11529 CPD-11529] == * common-name: ** (+)-7-epi-jasmonoyl-coa * smiles: ** ccc=ccc1(c(=o)cc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Type-1-transmemberane-domains Type-1-transmemberane-domains] == * common-name: ** type-1 transm...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11529 CPD-11529] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Type-1-transmemberane-domains Type-1-transmemberane-domains] ==
 
* common-name:
 
* common-name:
** (+)-7-epi-jasmonoyl-coa
+
** type-1 transmembrane proteins
* smiles:
 
** ccc=ccc1(c(=o)ccc1cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
 
* inchi-key:
 
** wqkkcppndksaiu-cbgydujusa-j
 
* molecular-weight:
 
** 955.76
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10708]]
+
* [[3.4.21.105-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10701]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(+)-7-epi-jasmonoyl-coa}}
+
{{#set: common-name=type-1 transmembrane proteins}}
{{#set: inchi-key=inchikey=wqkkcppndksaiu-cbgydujusa-j}}
 
{{#set: molecular-weight=955.76}}
 

Revision as of 14:20, 26 August 2019

Metabolite Type-1-transmemberane-domains

  • common-name:
    • type-1 transmembrane proteins

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality