Difference between revisions of "SJ10594"

Revision as of 14:20, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-194 CPD-194] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ERYTHROSE-4P ERYTHROSE-4P] ==
 * common-name:
-** 4-nitrophenyl phosphate
+** d-erythrose 4-phosphate
 * smiles:
-** c1(=cc(op([o-])(=o)[o-])=cc=c([n+]([o-])=o)1)
+** [ch](c(c(cop([o-])([o-])=o)o)o)=o
 * inchi-key:
-** xzkihkmtemtjqx-uhfffaoysa-l
+** nghmdnpxvrffgs-iuyqgcfvsa-l
 * molecular-weight:
-** 217.074
+** 198.069
 == Reaction(s) known to consume the compound ==
-* [[4-NITROPHENYLPHOSPHATASE-RXN]]
+* [[2TRANSKETO-RXN]]
+* [[DAHPSYN-RXN]]
+* [[SEDOBISALDOL-RXN]]
+* [[TRANSALDOL-RXN]]
 == Reaction(s) known to produce the compound ==
+* [[2TRANSKETO-RXN]]
+* [[DAHPSYN-RXN]]
+* [[SEDOBISALDOL-RXN]]
+* [[TRANSALDOL-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=4-nitrophenyl phosphate}}
+{{#set: common-name=d-erythrose 4-phosphate}}
-{{#set: inchi-key=inchikey=xzkihkmtemtjqx-uhfffaoysa-l}}
+{{#set: inchi-key=inchikey=nghmdnpxvrffgs-iuyqgcfvsa-l}}
-{{#set: molecular-weight=217.074}}
+{{#set: molecular-weight=198.069}}