Difference between revisions of "SJ10594"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ERYTHROSE-4P ERYTHROSE-4P] == * common-name: ** d-erythrose 4-phosphate * smiles: ** [ch](c(c(c...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-609 CPD-609] == * common-name: ** p1,p4-bis(5'-guanosyl) tetraphosphate * smiles: ** c(op(=...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-609 CPD-609] == |
* common-name: | * common-name: | ||
− | ** | + | ** p1,p4-bis(5'-guanosyl) tetraphosphate |
* smiles: | * smiles: | ||
− | ** [ | + | ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))))c4(oc(c(o)c(o)4)n6(c=nc5(c(=o)nc(n)=nc=56))) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** olgwxcqxrssqpo-mharetsrsa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 864.359 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[3.6.1.17-RXN]] |
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=p1,p4-bis(5'-guanosyl) tetraphosphate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=olgwxcqxrssqpo-mharetsrsa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=864.359}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite CPD-609
- common-name:
- p1,p4-bis(5'-guanosyl) tetraphosphate
- smiles:
- c(op(=o)([o-])op(=o)([o-])op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))))c4(oc(c(o)c(o)4)n6(c=nc5(c(=o)nc(n)=nc=56)))
- inchi-key:
- olgwxcqxrssqpo-mharetsrsa-j
- molecular-weight:
- 864.359