Difference between revisions of "SJ10605"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP CDP] == * common-name: ** cdp * smiles: ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op(op([o-...")
(Created page with "Category:gene == Gene SJ10605 == * transcription-direction: ** positive * right-end-position: ** 90245 * left-end-position: ** 76784 * centisome-position: ** 19.783775...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP CDP] ==
+
== Gene SJ10605 ==
* common-name:
+
* transcription-direction:
** cdp
+
** positive
* smiles:
+
* right-end-position:
** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op(op([o-])([o-])=o)([o-])=o
+
** 90245
* inchi-key:
+
* left-end-position:
** zwiadyzpowuwew-xvfcmesisa-k
+
** 76784
* molecular-weight:
+
* centisome-position:
** 400.155
+
** 19.783775   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[ATCD]]
+
* [[S.japonica_carotenoid_curated]]
* [[ATCDm]]
+
== Reaction(s) associated ==
* [[CDPKIN-RXN]]
+
* [[3.1.13.4-RXN]]
* [[CDPREDUCT-RXN]]
+
** Category: [[annotation]]
* [[DCDT]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RIBONUCLEOSIDE-DIP-REDUCTII-RXN]]
+
{{#set: transcription-direction=positive}}
* [[RXN-12198]]
+
{{#set: right-end-position=90245}}
== Reaction(s) known to produce the compound ==
+
{{#set: left-end-position=76784}}
* [[ATCM]]
+
{{#set: centisome-position=19.783775    }}
* [[DOLICHOL-KINASE-RXN]]
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
* [[RXN-11832]]
+
{{#set: nb reaction associated=1}}
* [[RXN-12195]]
 
* [[RXN-12959]]
 
* [[RXN-15091]]
 
* [[RXN-7683]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=cdp}}
 
{{#set: inchi-key=inchikey=zwiadyzpowuwew-xvfcmesisa-k}}
 
{{#set: molecular-weight=400.155}}
 

Latest revision as of 11:00, 18 March 2021

Gene SJ10605

  • transcription-direction:
    • positive
  • right-end-position:
    • 90245
  • left-end-position:
    • 76784
  • centisome-position:
    • 19.783775

Organism(s) associated with this gene

Reaction(s) associated