Difference between revisions of "SJ10605"

Revision as of 09:23, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP CDP] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Methyl-Saturated-Fatty-Acids 3-Methyl-Saturated-Fatty-Acids] ==
 * common-name:
-** cdp
+** a 3-methyl-branched 2,3,4-saturated fatty acid
-* smiles:
-** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op(op([o-])([o-])=o)([o-])=o
-* inchi-key:
-** zwiadyzpowuwew-xvfcmesisa-k
-* molecular-weight:
-** 400.155
 == Reaction(s) known to consume the compound ==
-* [[ATCD]]
+* [[RXN66-469]]
-* [[ATCDm]]
-* [[CDPKIN-RXN]]
-* [[CDPREDUCT-RXN]]
-* [[DCDT]]
-* [[RIBONUCLEOSIDE-DIP-REDUCTII-RXN]]
-* [[RXN-12198]]
 == Reaction(s) known to produce the compound ==
-* [[ATCM]]
-* [[DOLICHOL-KINASE-RXN]]
-* [[RXN-11832]]
-* [[RXN-12195]]
-* [[RXN-12959]]
-* [[RXN-15091]]
-* [[RXN-7683]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=cdp}}
+{{#set: common-name=a 3-methyl-branched 2,3,4-saturated fatty acid}}
-{{#set: inchi-key=inchikey=zwiadyzpowuwew-xvfcmesisa-k}}
-{{#set: molecular-weight=400.155}}