Difference between revisions of "SJ10614"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=T2-DECENOYL-COA T2-DECENOYL-COA] == * common-name: ** (2e)-dec-2-enoyl-coa * smiles: ** ccccccc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-698 CPD-698] == * common-name: ** campest-4-en-3-one * smiles: ** cc(c)c(c)ccc(c)[ch]3(cc[c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=T2-DECENOYL-COA T2-DECENOYL-COA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-698 CPD-698] ==
 
* common-name:
 
* common-name:
** (2e)-dec-2-enoyl-coa
+
** campest-4-en-3-one
 
* smiles:
 
* smiles:
** cccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc(c)c(c)ccc(c)[ch]3(cc[ch]4([ch]2(ccc1(=cc(=o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** mgnbgcrqqfmnbm-yjhhllfwsa-j
+
** qqiopzfvtihasb-imudckkosa-n
 
* molecular-weight:
 
* molecular-weight:
** 915.738
+
** 398.671
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ECOAH4h]]
+
* [[RXN-4231]]
* [[RXN-13616]]
+
* [[RXN-711]]
* [[RXN-14805]]
 
* [[TRANS-2-ENOYL-COA-REDUCTASE-NAD+-RXN-CPD-10267/NAD//T2-DECENOYL-COA/NADH/PROTON.43.]]
 
* [[TRANSENOYLCOARED-RXN-CPD-10267/NADP//T2-DECENOYL-COA/NADPH/PROTON.45.]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DIENOYLCOAREDUCT-RXN]]
 
* [[ECOAH4h]]
 
* [[RXN-13615]]
 
* [[RXN-14805]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e)-dec-2-enoyl-coa}}
+
{{#set: common-name=campest-4-en-3-one}}
{{#set: inchi-key=inchikey=mgnbgcrqqfmnbm-yjhhllfwsa-j}}
+
{{#set: inchi-key=inchikey=qqiopzfvtihasb-imudckkosa-n}}
{{#set: molecular-weight=915.738}}
+
{{#set: molecular-weight=398.671}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-698

  • common-name:
    • campest-4-en-3-one
  • smiles:
    • cc(c)c(c)ccc(c)[ch]3(cc[ch]4([ch]2(ccc1(=cc(=o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • qqiopzfvtihasb-imudckkosa-n
  • molecular-weight:
    • 398.671

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality