Difference between revisions of "SJ10684"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FORMATE FORMATE] == * common-name: ** formate * smiles: ** [ch]([o-])=o * inchi-key: ** bdagihx...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13665 CPD-13665] == * common-name: ** n-acetyl-d-glucosamine 6-sulfate * smiles: ** cc(=o)n...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13665 CPD-13665] == |
* common-name: | * common-name: | ||
| − | ** | + | ** n-acetyl-d-glucosamine 6-sulfate |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(=o)nc1(c(o)oc(cos(=o)([o-])=o)c(o)c(o)1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wjfveeaiyioath-rtrlpjtcsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 300.26 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-16512]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-16512]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[ | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n-acetyl-d-glucosamine 6-sulfate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wjfveeaiyioath-rtrlpjtcsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=300.26}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite CPD-13665
- common-name:
- n-acetyl-d-glucosamine 6-sulfate
- smiles:
- cc(=o)nc1(c(o)oc(cos(=o)([o-])=o)c(o)c(o)1)
- inchi-key:
- wjfveeaiyioath-rtrlpjtcsa-m
- molecular-weight:
- 300.26
