Difference between revisions of "SJ10711"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8092 CPD-8092] == * common-name: ** 1-oleoyl-2-α-linolenoyl-phosphatidylcholine * smi...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Holo-EntF Holo-EntF] == * common-name: ** a holo-[entf peptidyl-carrier protein] == Reaction(s)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8092 CPD-8092] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Holo-EntF Holo-EntF] ==
 
* common-name:
 
* common-name:
** 1-oleoyl-2-α-linolenoyl-phosphatidylcholine
+
** a holo-[entf peptidyl-carrier protein]
* smiles:
 
** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=ccc=ccc)cop([o-])(=o)occ[n+](c)(c)c)=o
 
* inchi-key:
 
** fvqgnfubhwgfcy-hjoyqdmmsa-n
 
* molecular-weight:
 
** 782.092
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8324]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8326]]
+
* [[RXN-15889]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-oleoyl-2-α-linolenoyl-phosphatidylcholine}}
+
{{#set: common-name=a holo-[entf peptidyl-carrier protein]}}
{{#set: inchi-key=inchikey=fvqgnfubhwgfcy-hjoyqdmmsa-n}}
 
{{#set: molecular-weight=782.092}}
 

Revision as of 14:19, 26 August 2019

Metabolite Holo-EntF

  • common-name:
    • a holo-[entf peptidyl-carrier protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a holo-[entf peptidyl-carrier protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.