Difference between revisions of "SJ10758"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-I-CIT HOMO-I-CIT] == * common-name: ** (1r,2s)-homoisocitrate * smiles: ** c(cc(=o)[o-])c(...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUTATHIONE GLUTATHIONE] == * common-name: ** glutathione * smiles: ** c(s)c(c(ncc([o-])=o)=o)n...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-I-CIT HOMO-I-CIT] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUTATHIONE GLUTATHIONE] ==
 
* common-name:
 
* common-name:
** (1r,2s)-homoisocitrate
+
** glutathione
 
* smiles:
 
* smiles:
** c(cc(=o)[o-])c(c(=o)[o-])c(o)c(=o)[o-]
+
** c(s)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
 
* inchi-key:
 
* inchi-key:
** oejzzcgrgvfwhk-wvzvxsggsa-k
+
** rwsxrvcmgqzwbv-wdskdsinsa-m
 
* molecular-weight:
 
* molecular-weight:
** 203.128
+
** 306.313
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[HOMOACONITATE-HYDRATASE-RXN]]
+
* [[1.11.1.12-RXN]]
* [[RXN-13722]]
+
* [[1.8.4.9-RXN]]
 +
* [[1.8.5.1-RXN]]
 +
* [[2.3.2.15-RXN]]
 +
* [[GLUTATHIONE-PEROXIDASE-RXN]]
 +
* [[GLYOXI-RXN]]
 +
* [[GSHTRAN-RXN]]
 +
* [[GST-RXN]]
 +
* [[GTHP]]
 +
* [[LEUKOTRIENE-C4-SYNTHASE-RXN]]
 +
* [[RXN-12618]]
 +
* [[RXN-13673]]
 +
* [[RXN-15680]]
 +
* [[RXN-18092]]
 +
* [[RXN-6601]]
 +
* [[RXN-9157]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HOMOACONITATE-HYDRATASE-RXN]]
+
* [[GDR]]
* [[RXN-13722]]
+
* [[GDR_LPAREN_nadp_RPAREN_]]
 +
* [[GDR_LPAREN_nadp_RPAREN_h]]
 +
* [[GDR_LPAREN_nadp_RPAREN_m]]
 +
* [[GDRh]]
 +
* [[GDRm]]
 +
* [[GLUTATHIONE-REDUCT-NADPH-RXN]]
 +
* [[GLUTATHIONE-SYN-RXN]]
 +
* [[GLYOXI-RXN]]
 +
* [[GLYOXII-RXN]]
 +
* [[GST-RXN]]
 +
* [[RXN-13161]]
 +
* [[RXN-7919]]
 +
* [[S-FORMYLGLUTATHIONE-HYDROLASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(1r,2s)-homoisocitrate}}
+
{{#set: common-name=glutathione}}
{{#set: inchi-key=inchikey=oejzzcgrgvfwhk-wvzvxsggsa-k}}
+
{{#set: inchi-key=inchikey=rwsxrvcmgqzwbv-wdskdsinsa-m}}
{{#set: molecular-weight=203.128}}
+
{{#set: molecular-weight=306.313}}

Revision as of 09:24, 27 August 2019