Difference between revisions of "SJ10760"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15913 CPD-15913] == * common-name: ** aurachin c epoxide * smiles: ** cc(c)=cccc(c)=cccc(c)...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-oxo-arachidoyl-ACPs 3-oxo-arachidoyl-ACPs] == * common-name: ** a 3-oxo-arachidoyl-[acp] == R...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15913 CPD-15913] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-oxo-arachidoyl-ACPs 3-oxo-arachidoyl-ACPs] ==
 
* common-name:
 
* common-name:
** aurachin c epoxide
+
** a 3-oxo-arachidoyl-[acp]
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=ccc12(oc(c)1n(c3(c=cc=cc(c2=o)=3))o)
 
* inchi-key:
 
** forhhprbeftlrm-yefhwucqsa-n
 
* molecular-weight:
 
** 395.541
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN1G-349]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15029]]
+
* [[RXN1G-368]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=aurachin c epoxide}}
+
{{#set: common-name=a 3-oxo-arachidoyl-[acp]}}
{{#set: inchi-key=inchikey=forhhprbeftlrm-yefhwucqsa-n}}
 
{{#set: molecular-weight=395.541}}
 

Revision as of 14:20, 26 August 2019

Metabolite 3-oxo-arachidoyl-ACPs

  • common-name:
    • a 3-oxo-arachidoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 3-oxo-arachidoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.