Difference between revisions of "SJ10771"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ferrihemoglobins Ferrihemoglobins] == * common-name: ** a ferrihemoglobin == Reaction(s) known...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SN-GLYCEROL-1-PHOSPHATE SN-GLYCEROL-1-PHOSPHATE] == * common-name: ** sn-glycerol 1-phosphate *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ferrihemoglobins Ferrihemoglobins] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SN-GLYCEROL-1-PHOSPHATE SN-GLYCEROL-1-PHOSPHATE] ==
 
* common-name:
 
* common-name:
** a ferrihemoglobin
+
** sn-glycerol 1-phosphate
 +
* smiles:
 +
** c(op([o-])(=o)[o-])c(o)co
 +
* inchi-key:
 +
** awucvroldviajx-vkhmyheasa-l
 +
* molecular-weight:
 +
** 170.058
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11195]]
+
* [[2.5.1.41-RXN]]
 +
* [[RXN-14964]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a ferrihemoglobin}}
+
{{#set: common-name=sn-glycerol 1-phosphate}}
 +
{{#set: inchi-key=inchikey=awucvroldviajx-vkhmyheasa-l}}
 +
{{#set: molecular-weight=170.058}}

Revision as of 09:24, 27 August 2019

Metabolite SN-GLYCEROL-1-PHOSPHATE

  • common-name:
    • sn-glycerol 1-phosphate
  • smiles:
    • c(op([o-])(=o)[o-])c(o)co
  • inchi-key:
    • awucvroldviajx-vkhmyheasa-l
  • molecular-weight:
    • 170.058

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality