Difference between revisions of "SJ10812"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-THYROXINE L-THYROXINE] == * common-name: ** l-thyroxine * smiles: ** c(=o)([o-])c([n+])cc1(c=...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-208 CPD-208] == * common-name: ** (s)-malyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-208 CPD-208] == |
* common-name: | * common-name: | ||
| − | ** | + | ** (s)-malyl-coa |
* smiles: | * smiles: | ||
| − | ** c(=o)([o-]) | + | ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(c([o-])=o)o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** hjqwlhmlmcdael-ztgltyrusa-i |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 878.568 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-14937]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(s)-malyl-coa}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hjqwlhmlmcdael-ztgltyrusa-i}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=878.568}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite CPD-208
- common-name:
- (s)-malyl-coa
- smiles:
- cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(c([o-])=o)o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- hjqwlhmlmcdael-ztgltyrusa-i
- molecular-weight:
- 878.568
