Difference between revisions of "SJ10887"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12124 CPD-12124] == * common-name: ** menaquinol-6 * smiles: ** cc(=cccc(c)=cccc(c)=cccc(c)...")
(Created page with "Category:gene == Gene SJ10887 == * transcription-direction: ** negative * right-end-position: ** 204576 * left-end-position: ** 196644 * centisome-position: ** 51.493126...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12124 CPD-12124] ==
+
== Gene SJ10887 ==
−
* common-name:
+
* transcription-direction:
−
** menaquinol-6
+
** negative
−
* smiles:
+
* right-end-position:
−
** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc2(c(c)=c(o)c1(c=cc=cc=1c(o)=2)))c
+
** 204576
−
* inchi-key:
+
* left-end-position:
−
** zventdgzqvbwna-rciygobdsa-n
+
** 196644
−
* molecular-weight:
+
* centisome-position:
−
** 582.908
+
** 51.493126   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
== Reaction(s) known to produce the compound ==
+
* [[S.japonica_carotenoid_curated]]
−
* [[RXN-9220]]
+
== Reaction(s) associated ==
−
== Reaction(s) of unknown directionality ==
+
* [[RXN-12353]]
−
{{#set: common-name=menaquinol-6}}
+
** Category: [[annotation]]
−
{{#set: inchi-key=inchikey=zventdgzqvbwna-rciygobdsa-n}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: molecular-weight=582.908}}
+
* [[RXN0-984]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[RXN0-985]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[RXN0-986]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=204576}}
 +
{{#set: left-end-position=196644}}
 +
{{#set: centisome-position=51.493126    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=4}}

Latest revision as of 11:00, 18 March 2021

Gene SJ10887

  • transcription-direction:
    • negative
  • right-end-position:
    • 204576
  • left-end-position:
    • 196644
  • centisome-position:
    • 51.493126

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ10887&oldid=131754"