Difference between revisions of "SJ10890"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12936 CPD-12936] == * common-name: ** apo-4'-lycopenal * smiles: ** cc(c)=cccc(c)=cc=cc(c)=...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCOL GLYCOL] == * common-name: ** ethylene glycol * smiles: ** c(co)o * inchi-key: ** lycaiko...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12936 CPD-12936] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCOL GLYCOL] ==
 
* common-name:
 
* common-name:
** apo-4'-lycopenal
+
** ethylene glycol
 
* smiles:
 
* smiles:
** cc(c)=cccc(c)=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(c)c=o
+
** c(co)o
 
* inchi-key:
 
* inchi-key:
** qpkntqummsiklq-ymwarttesa-n
+
** lycaikowrpuztn-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 482.748
+
** 62.068
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11999]]
+
* [[RXN-14023]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=apo-4'-lycopenal}}
+
{{#set: common-name=ethylene glycol}}
{{#set: inchi-key=inchikey=qpkntqummsiklq-ymwarttesa-n}}
+
{{#set: inchi-key=inchikey=lycaikowrpuztn-uhfffaoysa-n}}
{{#set: molecular-weight=482.748}}
+
{{#set: molecular-weight=62.068}}

Revision as of 09:24, 27 August 2019

Metabolite GLYCOL

  • common-name:
    • ethylene glycol
  • smiles:
    • c(co)o
  • inchi-key:
    • lycaikowrpuztn-uhfffaoysa-n
  • molecular-weight:
    • 62.068

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality