Difference between revisions of "SJ10996"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-380 CPD-380] == * common-name: ** 3-sulfopyruvate * smiles: ** c(=o)([o-])c(=o)cs(=o)(=o)[o...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORIBOSYL-FORMAMIDO-CARBOXAMIDE PHOSPHORIBOSYL-FORMAMIDO-CARBOXAMIDE] == * common-name: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-380 CPD-380] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORIBOSYL-FORMAMIDO-CARBOXAMIDE PHOSPHORIBOSYL-FORMAMIDO-CARBOXAMIDE] ==
 
* common-name:
 
* common-name:
** 3-sulfopyruvate
+
** 5-formamido-1-(5-phospho-d-ribosyl)-imidazole-4-carboxamide
 
* smiles:
 
* smiles:
** c(=o)([o-])c(=o)cs(=o)(=o)[o-]
+
** c(op([o-])(=o)[o-])c2(c(o)c(o)c(n1(c=nc(c(=o)n)=c(nc=o)1))o2)
 
* inchi-key:
 
* inchi-key:
** buthmsuebypmkj-uhfffaoysa-l
+
** abcooorlyaoboz-kqynxxcusa-l
 
* molecular-weight:
 
* molecular-weight:
** 166.105
+
** 364.208
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[R230-RXN]]
+
* [[AICARTRANSFORM-RXN]]
* [[RXN-11737]]
+
* [[FPAIF]]
 +
* [[IMPCYCLOHYDROLASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[R230-RXN]]
+
* [[AICARTRANSFORM-RXN]]
* [[RXN-11737]]
+
* [[FPAIF]]
 +
* [[IMPCYCLOHYDROLASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-sulfopyruvate}}
+
{{#set: common-name=5-formamido-1-(5-phospho-d-ribosyl)-imidazole-4-carboxamide}}
{{#set: inchi-key=inchikey=buthmsuebypmkj-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=abcooorlyaoboz-kqynxxcusa-l}}
{{#set: molecular-weight=166.105}}
+
{{#set: molecular-weight=364.208}}

Revision as of 14:20, 26 August 2019

Metabolite PHOSPHORIBOSYL-FORMAMIDO-CARBOXAMIDE

  • common-name:
    • 5-formamido-1-(5-phospho-d-ribosyl)-imidazole-4-carboxamide
  • smiles:
    • c(op([o-])(=o)[o-])c2(c(o)c(o)c(n1(c=nc(c(=o)n)=c(nc=o)1))o2)
  • inchi-key:
    • abcooorlyaoboz-kqynxxcusa-l
  • molecular-weight:
    • 364.208

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality