Difference between revisions of "SJ11010"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15656 CPD-15656] == * common-name: ** (3e)-undec-2-enoyl-coa * smiles: ** ccccccccc=cc(=o)s...")
 
(Created page with "Category:gene == Gene SJ11010 == * transcription-direction: ** negative * right-end-position: ** 1251232 * left-end-position: ** 1243202 * centisome-position: ** 86.065765...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15656 CPD-15656] ==
+
== Gene SJ11010 ==
* common-name:
+
* transcription-direction:
** (3e)-undec-2-enoyl-coa
+
** negative
* smiles:
+
* right-end-position:
** ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** 1251232
* inchi-key:
+
* left-end-position:
** cavmkinpgrcurl-phhhidlgsa-j
+
** 1243202
* molecular-weight:
+
* centisome-position:
** 929.765
+
** 86.065765   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-14778]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[PROTEIN-KINASE-RXN]]
{{#set: common-name=(3e)-undec-2-enoyl-coa}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=cavmkinpgrcurl-phhhidlgsa-j}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=929.765}}
+
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=1251232}}
 +
{{#set: left-end-position=1243202}}
 +
{{#set: centisome-position=86.065765    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}

Latest revision as of 11:04, 18 March 2021

Gene SJ11010

  • transcription-direction:
    • negative
  • right-end-position:
    • 1251232
  • left-end-position:
    • 1243202
  • centisome-position:
    • 86.065765

Organism(s) associated with this gene

Reaction(s) associated