Difference between revisions of "SJ11010"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15656 CPD-15656] == * common-name: ** (3e)-undec-2-enoyl-coa * smiles: ** ccccccccc=cc(=o)s...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-DEOXYRIBOSE 2-DEOXYRIBOSE] == * common-name: ** 2'-deoxyribose * smiles: ** c(o)c(o)c(o)cc=o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15656 CPD-15656] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-DEOXYRIBOSE 2-DEOXYRIBOSE] ==
 
* common-name:
 
* common-name:
** (3e)-undec-2-enoyl-coa
+
** 2'-deoxyribose
 
* smiles:
 
* smiles:
** ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c(o)c(o)c(o)cc=o
 
* inchi-key:
 
* inchi-key:
** cavmkinpgrcurl-phhhidlgsa-j
+
** asjsaqirzkanqn-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 929.765
+
** 134.132
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14778]]
+
* [[RXN-14223]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3e)-undec-2-enoyl-coa}}
+
{{#set: common-name=2'-deoxyribose}}
{{#set: inchi-key=inchikey=cavmkinpgrcurl-phhhidlgsa-j}}
+
{{#set: inchi-key=inchikey=asjsaqirzkanqn-uhfffaoysa-n}}
{{#set: molecular-weight=929.765}}
+
{{#set: molecular-weight=134.132}}

Revision as of 14:20, 26 August 2019

Metabolite 2-DEOXYRIBOSE

  • common-name:
    • 2'-deoxyribose
  • smiles:
    • c(o)c(o)c(o)cc=o
  • inchi-key:
    • asjsaqirzkanqn-uhfffaoysa-n
  • molecular-weight:
    • 134.132

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality