Difference between revisions of "SJ11010"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9871 CPD-9871] == * common-name: ** 6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquin...")
(Created page with "Category:gene == Gene SJ01350 == * transcription-direction: ** positive * right-end-position: ** 136650 * left-end-position: ** 130233 * centisome-position: ** 85.56252...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9871 CPD-9871] ==
+
== Gene SJ01350 ==
−
* common-name:
+
* transcription-direction:
−
** 6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol
+
** positive
−
* smiles:
+
* right-end-position:
−
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c)c)c)c)c
+
** 136650
−
* inchi-key:
+
* left-end-position:
−
** xcoxsblqzpfvgk-rgiwonjesa-n
+
** 130233
−
* molecular-weight:
+
* centisome-position:
−
** 835.347
+
** 85.56252   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
== Reaction(s) known to produce the compound ==
+
* [[S.japonica_sterols_curated]]
−
* [[RXN-9235]]
+
== Reaction(s) associated ==
−
== Reaction(s) of unknown directionality ==
+
* [[2.7.12.1-RXN]]
−
{{#set: common-name=6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol}}
+
** Category: [[annotation]]
−
{{#set: inchi-key=inchikey=xcoxsblqzpfvgk-rgiwonjesa-n}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: molecular-weight=835.347}}
+
* [[PROTEIN-KINASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
* [[RXN-14906]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=136650}}
 +
{{#set: left-end-position=130233}}
 +
{{#set: centisome-position=85.56252    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=3}}

Revision as of 20:22, 18 December 2020

Gene SJ01350

  • transcription-direction:
    • positive
  • right-end-position:
    • 136650
  • left-end-position:
    • 130233
  • centisome-position:
    • 85.56252

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ11010&oldid=42141"