Difference between revisions of "SJ11011"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE TREHALOSE] == * common-name: ** α,α-trehalose * smiles: ** c(c1(oc(c(c(c1...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11497 CPD-11497] == * common-name: ** 3-methoxy-4-hydroxyphenylglycol * smiles: ** coc1(=c(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11497 CPD-11497] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-methoxy-4-hydroxyphenylglycol |
* smiles: | * smiles: | ||
| − | ** | + | ** coc1(=c(o)c=cc(c(o)co)=c1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** fbwpwwwzwkpjfl-qmmmgpobsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 184.191 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-10915]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-10915]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-methoxy-4-hydroxyphenylglycol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fbwpwwwzwkpjfl-qmmmgpobsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=184.191}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-11497
- common-name:
- 3-methoxy-4-hydroxyphenylglycol
- smiles:
- coc1(=c(o)c=cc(c(o)co)=c1)
- inchi-key:
- fbwpwwwzwkpjfl-qmmmgpobsa-n
- molecular-weight:
- 184.191
