Difference between revisions of "SJ11011"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11497 CPD-11497] == * common-name: ** 3-methoxy-4-hydroxyphenylglycol * smiles: ** coc1(=c(...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-TOCOPHEROL ALPHA-TOCOPHEROL] == * common-name: ** α-tocopherol * smiles: ** cc(c)cc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-TOCOPHEROL ALPHA-TOCOPHEROL] == |
* common-name: | * common-name: | ||
| − | ** | + | ** α-tocopherol |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=c(c(o)=c(c)c(=c(o1)2)c)c)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** gvjhhuawpyxkbd-ieosbipesa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 430.713 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[TOCOPHEROL-O-METHYLTRANSFERASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=α-tocopherol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=gvjhhuawpyxkbd-ieosbipesa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=430.713}} |
Revision as of 09:23, 27 August 2019
Contents
Metabolite ALPHA-TOCOPHEROL
- common-name:
- α-tocopherol
- smiles:
- cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=c(c(o)=c(c)c(=c(o1)2)c)c))
- inchi-key:
- gvjhhuawpyxkbd-ieosbipesa-n
- molecular-weight:
- 430.713
