Difference between revisions of "SJ11059"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRUCTOSE-6P FRUCTOSE-6P] == * common-name: ** β-d-fructofuranose 6-phosphate * smiles: **...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=All-trans-Retinyl-Esters All-trans-Retinyl-Esters] == * common-name: ** an all-trans-retinyl es...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRUCTOSE-6P FRUCTOSE-6P] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=All-trans-Retinyl-Esters All-trans-Retinyl-Esters] ==
 
* common-name:
 
* common-name:
** β-d-fructofuranose 6-phosphate
+
** an all-trans-retinyl ester
* smiles:
 
** c(op(=o)([o-])[o-])c1(oc(co)(o)c(o)c(o)1)
 
* inchi-key:
 
** bgwgxpapygqalx-arqdhwqxsa-l
 
* molecular-weight:
 
** 258.121
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.1.90-RXN]]
+
* [[RETINOL-O-FATTY-ACYLTRANSFERASE-RXN]]
* [[2TRANSKETO-RXN]]
+
* [[RXN-12575]]
* [[6-PHOSPHOFRUCTO-2-KINASE-RXN]]
 
* [[6PFRUCTPHOS-RXN]]
 
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
 
* [[MANNPDEHYDROG-RXN]]
 
* [[MANNPISOM-RXN]]
 
* [[MANNPISOM-RXN-MANNOSE-6P//FRUCTOSE-6P.24.]]
 
* [[PFK_]]
 
* [[PGIA]]
 
* [[PGIAh]]
 
* [[PGIB]]
 
* [[PGIBh]]
 
* [[PGLUCISOM-RXN]]
 
* [[RXN-14812]]
 
* [[TRANSALDOL-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.1.90-RXN]]
+
* [[RETINOL-O-FATTY-ACYLTRANSFERASE-RXN]]
* [[2TRANSKETO-RXN]]
 
* [[3.1.3.46-RXN]]
 
* [[F16BDEPHOS-RXN]]
 
* [[FRUCTOKINASE-RXN]]
 
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
 
* [[MANNPDEHYDROG-RXN]]
 
* [[MANNPISOM-RXN]]
 
* [[MANNPISOM-RXN-MANNOSE-6P//FRUCTOSE-6P.24.]]
 
* [[PGIA]]
 
* [[PGIAh]]
 
* [[PGIB]]
 
* [[PGIBh]]
 
* [[PGLUCISOM-RXN]]
 
* [[RXN-14812]]
 
* [[TRANSALDOL-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-d-fructofuranose 6-phosphate}}
+
{{#set: common-name=an all-trans-retinyl ester}}
{{#set: inchi-key=inchikey=bgwgxpapygqalx-arqdhwqxsa-l}}
 
{{#set: molecular-weight=258.121}}
 

Revision as of 14:19, 26 August 2019

Metabolite All-trans-Retinyl-Esters

  • common-name:
    • an all-trans-retinyl ester

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality