Difference between revisions of "SJ11123"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8901 CPD-8901] == * common-name: ** a [protein] n6-methyl-l-lysine == Reaction(s) known to...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12018 CPD-12018] == * common-name: ** 5-methoxytryptamine * smiles: ** coc2(c=cc1(=c(c(ccn)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12018 CPD-12018] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5-methoxytryptamine |
| + | * smiles: | ||
| + | ** coc2(c=cc1(=c(c(ccn)=cn1)c=2)) | ||
| + | * inchi-key: | ||
| + | ** jtejppkmybdemy-uhfffaoysa-n | ||
| + | * molecular-weight: | ||
| + | ** 190.244 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-11067]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5-methoxytryptamine}} |
| + | {{#set: inchi-key=inchikey=jtejppkmybdemy-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=190.244}} | ||
Revision as of 09:24, 27 August 2019
Contents
Metabolite CPD-12018
- common-name:
- 5-methoxytryptamine
- smiles:
- coc2(c=cc1(=c(c(ccn)=cn1)c=2))
- inchi-key:
- jtejppkmybdemy-uhfffaoysa-n
- molecular-weight:
- 190.244
