Difference between revisions of "SJ11185"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-511 CPD-511] == * common-name: ** pantetheine * smiles: ** cc(c(o)c(=o)nccc(nccs)=o)(c)co *...") |
(Created page with "Category:gene == Gene SJ11185 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * RR-BUTANEDIOL-DEHYDROGEN...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:gene]] |
− | == | + | == Gene SJ11185 == |
− | * | + | == Organism(s) associated with this gene == |
− | + | * [[S.japonica_carotenoid_curated]] | |
− | + | == Reaction(s) associated == | |
− | + | * [[RR-BUTANEDIOL-DEHYDROGENASE-RXN]] | |
− | * | + | ** Category: [[orthology]] |
− | + | *** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a | |
− | * | + | == Pathway(s) associated == |
− | ** | + | * [[PWY-5951]] |
− | == | + | ** '''1''' reactions found over '''1''' reactions in the full pathway |
− | * [[ | + | * [[PWY3O-246]] |
− | + | ** '''1''' reactions found over '''1''' reactions in the full pathway | |
− | * [[ | + | {{#set: organism associated=S.japonica_carotenoid_curated}} |
− | + | {{#set: nb reaction associated=1}} | |
− | {{#set: | + | {{#set: nb pathway associated=2}} |
− | {{#set: | ||
− | {{#set: |
Latest revision as of 11:03, 18 March 2021
Contents
Gene SJ11185
Organism(s) associated with this gene
Reaction(s) associated
- RR-BUTANEDIOL-DEHYDROGENASE-RXN
- Category: orthology
- source: output_pantograph_arabidopsis_thaliana; tool: pantograph; comment: n.a
- Category: orthology
Pathway(s) associated
- PWY-5951
- 1 reactions found over 1 reactions in the full pathway
- PWY3O-246
- 1 reactions found over 1 reactions in the full pathway