Difference between revisions of "SJ11185"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-D-XYLOSE UDP-D-XYLOSE] == * common-name: ** udp-α-d-xylose * smiles: ** c3(oc(op(=o)(...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-L-Aspartates Protein-L-Aspartates] == * common-name: ** a [protein]-l-aspartate == Reac...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-D-XYLOSE UDP-D-XYLOSE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-L-Aspartates Protein-L-Aspartates] ==
 
* common-name:
 
* common-name:
** udp-α-d-xylose
+
** a [protein]-l-aspartate
* smiles:
 
** c3(oc(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))c(o)c(o)c(o)3)
 
* inchi-key:
 
** dqqdlyvhotzlor-ocimbmbzsa-l
 
* molecular-weight:
 
** 534.263
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.4.2.26-RXN]]
+
* [[PEPTIDE-ASPARTATE-BETA-DIOXYGENASE-RXN]]
* [[2.4.2.38-RXN]]
 
* [[2.7.7.11-RXN]]
 
* [[RXN-9104]]
 
* [[UA4E]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.7.11-RXN]]
+
* [[3.5.1.52-RXN]]
* [[UA4E]]
 
* [[UDP-GLUCURONATE-DECARBOXYLASE-RXN]]
 
* [[UGDC]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp-α-d-xylose}}
+
{{#set: common-name=a [protein]-l-aspartate}}
{{#set: inchi-key=inchikey=dqqdlyvhotzlor-ocimbmbzsa-l}}
 
{{#set: molecular-weight=534.263}}
 

Revision as of 14:20, 26 August 2019

Metabolite Protein-L-Aspartates

  • common-name:
    • a [protein]-l-aspartate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-l-aspartate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.