Difference between revisions of "SJ11200"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9700 CPD-9700] == * common-name: ** hypoglycin b * smiles: ** c=c1(c(cc(c(=o)[o-])nc(ccc([n...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIMP DIMP] == * common-name: ** dimp * smiles: ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIMP DIMP] == |
* common-name: | * common-name: | ||
| − | ** | + | ** dimp |
* smiles: | * smiles: | ||
| − | ** c | + | ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** phngfppxdjjadg-rrkcrqdmsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 330.193 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN0-1602]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dimp}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=phngfppxdjjadg-rrkcrqdmsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=330.193}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite DIMP
- common-name:
- dimp
- smiles:
- c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23)))
- inchi-key:
- phngfppxdjjadg-rrkcrqdmsa-l
- molecular-weight:
- 330.193
