Difference between revisions of "SJ11229"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHINE XANTHINE] == * common-name: ** xanthine * smiles: ** c12(nc(=o)nc(c=1n=cn2)=o) * inchi...") |
(Created page with "Category:gene == Gene SJ11229 == * transcription-direction: ** positive * right-end-position: ** 210900 * left-end-position: ** 206519 * centisome-position: ** 54.80123...") |
||
(9 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:gene]] |
− | == | + | == Gene SJ11229 == |
− | * | + | * transcription-direction: |
− | ** | + | ** positive |
− | * | + | * right-end-position: |
− | ** | + | ** 210900 |
− | * | + | * left-end-position: |
− | ** | + | ** 206519 |
− | * | + | * centisome-position: |
− | ** | + | ** 54.80123 |
− | == | + | == Organism(s) associated with this gene == |
− | * [[ | + | * [[S.japonica_carotenoid_curated]] |
− | * [[ | + | == Reaction(s) associated == |
− | * [[ | + | * [[2.7.10.1-RXN]] |
− | * [[ | + | ** Category: [[annotation]] |
− | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
− | * [[ | + | * [[2.7.12.1-RXN]] |
− | * [[ | + | ** Category: [[annotation]] |
− | * [[ | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
− | * [[ | + | * [[PROTEIN-KINASE-RXN]] |
− | * [[ | + | ** Category: [[annotation]] |
− | * [[ | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
− | * [[ | + | * [[RXN-14906]] |
− | + | ** Category: [[annotation]] | |
− | {{#set: | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
− | {{#set: | + | {{#set: transcription-direction=positive}} |
− | {{#set: | + | {{#set: right-end-position=210900}} |
+ | {{#set: left-end-position=206519}} | ||
+ | {{#set: centisome-position=54.80123 }} | ||
+ | {{#set: organism associated=S.japonica_carotenoid_curated}} | ||
+ | {{#set: nb reaction associated=4}} |
Latest revision as of 11:04, 18 March 2021
Gene SJ11229
- transcription-direction:
- positive
- right-end-position:
- 210900
- left-end-position:
- 206519
- centisome-position:
- 54.80123
Organism(s) associated with this gene
Reaction(s) associated
- 2.7.10.1-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
- 2.7.12.1-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
- PROTEIN-KINASE-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
- RXN-14906
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation