Difference between revisions of "SJ11229"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHINE XANTHINE] == * common-name: ** xanthine * smiles: ** c12(nc(=o)nc(c=1n=cn2)=o) * inchi...")
 
(Created page with "Category:gene == Gene SJ11229 == * transcription-direction: ** positive * right-end-position: ** 210900 * left-end-position: ** 206519 * centisome-position: ** 54.80123...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHINE XANTHINE] ==
+
== Gene SJ11229 ==
* common-name:
+
* transcription-direction:
** xanthine
+
** positive
* smiles:
+
* right-end-position:
** c12(nc(=o)nc(c=1n=cn2)=o)
+
** 210900
* inchi-key:
+
* left-end-position:
** lrfvtywoqmyalw-uhfffaoysa-n
+
** 206519
* molecular-weight:
+
* centisome-position:
** 152.112
+
** 54.80123   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN0-901]]
+
* [[S.japonica_carotenoid_curated]]
* [[XANTHINE-OXIDASE-RXN]]
+
== Reaction(s) associated ==
* [[XNDH]]
+
* [[2.7.10.1-RXN]]
* [[XPPRT]]
+
** Category: [[annotation]]
== Reaction(s) known to produce the compound ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[GUANINE-DEAMINASE-RXN]]
+
* [[2.7.12.1-RXN]]
* [[RXN-7682]]
+
** Category: [[annotation]]
* [[RXN0-363]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN0-901]]
+
* [[PROTEIN-KINASE-RXN]]
* [[XANDH]]
+
** Category: [[annotation]]
* [[XANTHOSINEPHOSPHORY-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[XPPRT]]
+
* [[RXN-14906]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=xanthine}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=lrfvtywoqmyalw-uhfffaoysa-n}}
+
{{#set: transcription-direction=positive}}
{{#set: molecular-weight=152.112}}
+
{{#set: right-end-position=210900}}
 +
{{#set: left-end-position=206519}}
 +
{{#set: centisome-position=54.80123    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=4}}

Latest revision as of 11:04, 18 March 2021

Gene SJ11229

  • transcription-direction:
    • positive
  • right-end-position:
    • 210900
  • left-end-position:
    • 206519
  • centisome-position:
    • 54.80123

Organism(s) associated with this gene

Reaction(s) associated