Difference between revisions of "SJ11243"

Revision as of 09:24, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11740 CPD-11740] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BIOTIN BIOTIN] ==
 * common-name:
-** carboxyphosphinopyruvate
+** biotin
 * smiles:
-** c(p(c([o-])=o)([o-])=o)c(=o)c(=o)[o-]
+** c1(sc(ccccc(=o)[o-])[ch]2(nc(=o)n[ch]12))
 * inchi-key:
-** ytkwpnbypyowcp-uhfffaoysa-k
+** ybjhbahktgyvgt-zkwxmuahsa-m
 * molecular-weight:
-** 193.029
+** 243.3
 == Reaction(s) known to consume the compound ==
-* [[RXN-10828]]
+* [[6.3.4.10-RXN]]
+* [[6.3.4.11-RXN]]
+* [[6.3.4.9-RXN]]
+* [[BIOTINLIG-RXN]]
+* [[ExchangeSeed-BIOTIN]]
+* [[RXN0-7192]]
+* [[TransportSeed-BIOTIN]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-10827]]
+* [[2.8.1.6-RXN]]
+* [[ExchangeSeed-BIOTIN]]
+* [[RXN-17473]]
+* [[TransportSeed-BIOTIN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=carboxyphosphinopyruvate}}
+{{#set: common-name=biotin}}
-{{#set: inchi-key=inchikey=ytkwpnbypyowcp-uhfffaoysa-k}}
+{{#set: inchi-key=inchikey=ybjhbahktgyvgt-zkwxmuahsa-m}}
-{{#set: molecular-weight=193.029}}
+{{#set: molecular-weight=243.3}}