Difference between revisions of "SJ11252"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9699 CPD-9699] == * common-name: ** hypoglycin a * smiles: ** c=c1(c(cc([n+])c([o-])=o)c1)...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2152 CPD0-2152] == * common-name: ** 1-18:0-2-lysophosphatidylethanolamine * smiles: ** cc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9699 CPD-9699] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2152 CPD0-2152] ==
 
* common-name:
 
* common-name:
** hypoglycin a
+
** 1-18:0-2-lysophosphatidylethanolamine
 
* smiles:
 
* smiles:
** c=c1(c(cc([n+])c([o-])=o)c1)
+
** cccccccccccccccccc(occ(o)cop([o-])(=o)occ[n+])=o
 
* inchi-key:
 
* inchi-key:
** oojzcxfxpzgubj-uhfffaoysa-n
+
** bbywoyafbuoufp-jochjyfzsa-n
 
* molecular-weight:
 
* molecular-weight:
** 141.169
+
** 481.608
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9157]]
+
* [[LPLPS1AGPE180h]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=hypoglycin a}}
+
{{#set: common-name=1-18:0-2-lysophosphatidylethanolamine}}
{{#set: inchi-key=inchikey=oojzcxfxpzgubj-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=bbywoyafbuoufp-jochjyfzsa-n}}
{{#set: molecular-weight=141.169}}
+
{{#set: molecular-weight=481.608}}

Revision as of 09:23, 27 August 2019

Metabolite CPD0-2152

  • common-name:
    • 1-18:0-2-lysophosphatidylethanolamine
  • smiles:
    • cccccccccccccccccc(occ(o)cop([o-])(=o)occ[n+])=o
  • inchi-key:
    • bbywoyafbuoufp-jochjyfzsa-n
  • molecular-weight:
    • 481.608

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality