Difference between revisions of "SJ11283"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10814 CPD-10814] == * common-name: ** glycyl-l-proline * smiles: ** c1(n(c(=o)c[n+])c(cc1)c...")
(Created page with "Category:gene == Gene SJ11283 == * transcription-direction: ** negative * right-end-position: ** 104152 * left-end-position: ** 85693 * centisome-position: ** 10.936409...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10814 CPD-10814] ==
+
== Gene SJ11283 ==
* common-name:
+
* transcription-direction:
** glycyl-l-proline
+
** negative
* smiles:
+
* right-end-position:
** c1(n(c(=o)c[n+])c(cc1)c(=o)[o-])
+
** 104152
* inchi-key:
+
* left-end-position:
** kznqnbzmbzjqjo-yfkpbyrvsa-n
+
** 85693
* molecular-weight:
+
* centisome-position:
** 172.183
+
** 10.936409   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN0-6988]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[5.3.4.1-RXN]]
{{#set: common-name=glycyl-l-proline}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=kznqnbzmbzjqjo-yfkpbyrvsa-n}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=172.183}}
+
* [[DISULISOM-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[RXN-15684]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[THIOL-OXIDASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[PWY-7533]]
 +
** '''3''' reactions found over '''9''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=104152}}
 +
{{#set: left-end-position=85693}}
 +
{{#set: centisome-position=10.936409    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=4}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:02, 18 March 2021

Gene SJ11283

  • transcription-direction:
    • negative
  • right-end-position:
    • 104152
  • left-end-position:
    • 85693
  • centisome-position:
    • 10.936409

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-7533
    • 3 reactions found over 9 reactions in the full pathway