Difference between revisions of "SJ11313"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ASPARTATE-SEMIALDEHYDE L-ASPARTATE-SEMIALDEHYDE] == * common-name: ** l-aspartate-semialdehyd...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11411 CPD-11411] == * common-name: ** tetraiodothyroacetate ester glucuronide * smiles: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ASPARTATE-SEMIALDEHYDE L-ASPARTATE-SEMIALDEHYDE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11411 CPD-11411] ==
 
* common-name:
 
* common-name:
** l-aspartate-semialdehyde
+
** tetraiodothyroacetate ester glucuronide
 
* smiles:
 
* smiles:
** [ch](=o)cc([n+])c(=o)[o-]
+
** c(oc1(c(o)c(o)c(o)c(c(=o)[o-])o1))(=o)cc2(=cc(i)=c(c(i)=c2)oc3(c=c(i)c(o)=c(i)c=3))
 
* inchi-key:
 
* inchi-key:
** hoswpdpvfbclsy-vkhmyheasa-n
+
** xzmjvzbexskssm-kfyubchvsa-m
 
* molecular-weight:
 
* molecular-weight:
** 117.104
+
** 922.95
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]]
 
* [[DIHYDRODIPICSYN-RXN]]
 
* [[HOMOSERDEHYDROG-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]]
+
* [[RXN-10617]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-aspartate-semialdehyde}}
+
{{#set: common-name=tetraiodothyroacetate ester glucuronide}}
{{#set: inchi-key=inchikey=hoswpdpvfbclsy-vkhmyheasa-n}}
+
{{#set: inchi-key=inchikey=xzmjvzbexskssm-kfyubchvsa-m}}
{{#set: molecular-weight=117.104}}
+
{{#set: molecular-weight=922.95}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-11411

  • common-name:
    • tetraiodothyroacetate ester glucuronide
  • smiles:
    • c(oc1(c(o)c(o)c(o)c(c(=o)[o-])o1))(=o)cc2(=cc(i)=c(c(i)=c2)oc3(c=c(i)c(o)=c(i)c=3))
  • inchi-key:
    • xzmjvzbexskssm-kfyubchvsa-m
  • molecular-weight:
    • 922.95

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality