Difference between revisions of "SJ11313"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-PARATHION AMINO-PARATHION] == * common-name: ** amino-parathion * smiles: ** ccop(oc1(c=c...")
(Created page with "Category:gene == Gene SJ16589 == * transcription-direction: ** negative * right-end-position: ** 184902 * left-end-position: ** 175608 * centisome-position: ** 25.695286...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-PARATHION AMINO-PARATHION] ==
+
== Gene SJ16589 ==
* common-name:
+
* transcription-direction:
** amino-parathion
+
** negative
* smiles:
+
* right-end-position:
** ccop(oc1(c=cc(=cc=1)n))(occ)=s
+
** 184902
* inchi-key:
+
* left-end-position:
** xizotxgjxstqdi-uhfffaoysa-n
+
** 175608
* molecular-weight:
+
* centisome-position:
** 261.275
+
** 25.695286   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[AMINOPARATHION-PHOSPHATASE-RXN]]
+
* [[S.japonica_sterols_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[PROTEIN-KINASE-RXN]]
{{#set: common-name=amino-parathion}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=xizotxgjxstqdi-uhfffaoysa-n}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=261.275}}
+
* [[RXN-8443]]
 +
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[PWY-5381]]
 +
** '''6''' reactions found over '''11''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=184902}}
 +
{{#set: left-end-position=175608}}
 +
{{#set: centisome-position=25.695286    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=2}}
 +
{{#set: nb pathway associated=1}}

Revision as of 20:19, 18 December 2020

Gene SJ16589

  • transcription-direction:
    • negative
  • right-end-position:
    • 184902
  • left-end-position:
    • 175608
  • centisome-position:
    • 25.695286

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-5381
    • 6 reactions found over 11 reactions in the full pathway