Difference between revisions of "SJ11316"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14122 CPD-14122] == * common-name: ** 2-deoxy-scyllo-inosamine * smiles: ** c1(c([n+])c(o)c...")
(Created page with "Category:gene == Gene SJ11316 == * transcription-direction: ** positive * right-end-position: ** 222098 * left-end-position: ** 213143 * centisome-position: ** 57.06197...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14122 CPD-14122] ==
+
== Gene SJ11316 ==
* common-name:
+
* transcription-direction:
** 2-deoxy-scyllo-inosamine
+
** positive
* smiles:
+
* right-end-position:
** c1(c([n+])c(o)c(o)c(o)c(o)1)
+
** 222098
* inchi-key:
+
* left-end-position:
** qxqnrsuoynmxdl-kgjvwpdlsa-o
+
** 213143
* molecular-weight:
+
* centisome-position:
** 164.181
+
** 57.06197   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-13118]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[3.4.13.9-RXN]]
{{#set: common-name=2-deoxy-scyllo-inosamine}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=qxqnrsuoynmxdl-kgjvwpdlsa-o}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=164.181}}
+
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=222098}}
 +
{{#set: left-end-position=213143}}
 +
{{#set: centisome-position=57.06197    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}

Latest revision as of 11:02, 18 March 2021

Gene SJ11316

  • transcription-direction:
    • positive
  • right-end-position:
    • 222098
  • left-end-position:
    • 213143
  • centisome-position:
    • 57.06197

Organism(s) associated with this gene

Reaction(s) associated