Difference between revisions of "SJ11316"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CITRULLINE L-CITRULLINE] == * common-name: ** l-citrulline * smiles: ** c(nc(n)=o)ccc([n+])c(...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14122 CPD-14122] == * common-name: ** 2-deoxy-scyllo-inosamine * smiles: ** c1(c([n+])c(o)c...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14122 CPD-14122] == |
* common-name: | * common-name: | ||
− | ** | + | ** 2-deoxy-scyllo-inosamine |
* smiles: | * smiles: | ||
− | ** c( | + | ** c1(c([n+])c(o)c(o)c(o)c(o)1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** qxqnrsuoynmxdl-kgjvwpdlsa-o |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 164.181 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | + | * [[RXN-13118]] | |
− | |||
− | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=2-deoxy-scyllo-inosamine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qxqnrsuoynmxdl-kgjvwpdlsa-o}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=164.181}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite CPD-14122
- common-name:
- 2-deoxy-scyllo-inosamine
- smiles:
- c1(c([n+])c(o)c(o)c(o)c(o)1)
- inchi-key:
- qxqnrsuoynmxdl-kgjvwpdlsa-o
- molecular-weight:
- 164.181