Difference between revisions of "SJ11360"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HEPARIN-GLUCOSAMINE-3-O-SULFATE HEPARIN-GLUCOSAMINE-3-O-SULFATE] == * common-name: ** a [hepara...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19147 CPD-19147] == * common-name: ** (7z)-tetradecenoyl-coa * smiles: ** ccccccc=ccccccc(=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19147 CPD-19147] == |
* common-name: | * common-name: | ||
| − | ** | + | ** (7z)-tetradecenoyl-coa |
| + | * smiles: | ||
| + | ** ccccccc=ccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
| + | * inchi-key: | ||
| + | ** jpihvkickvpffy-twafkmgksa-j | ||
| + | * molecular-weight: | ||
| + | ** 971.845 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-17792]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-17791]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(7z)-tetradecenoyl-coa}} |
| + | {{#set: inchi-key=inchikey=jpihvkickvpffy-twafkmgksa-j}} | ||
| + | {{#set: molecular-weight=971.845}} | ||
Revision as of 09:24, 27 August 2019
Contents
Metabolite CPD-19147
- common-name:
- (7z)-tetradecenoyl-coa
- smiles:
- ccccccc=ccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- jpihvkickvpffy-twafkmgksa-j
- molecular-weight:
- 971.845
