Difference between revisions of "SJ11360"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19147 CPD-19147] == * common-name: ** (7z)-tetradecenoyl-coa * smiles: ** ccccccc=ccccccc(=...")
(Created page with "Category:gene == Gene SJ08089 == * transcription-direction: ** negative * right-end-position: ** 5147 * left-end-position: ** 4527 * centisome-position: ** 7.7938848 =...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19147 CPD-19147] ==
+
== Gene SJ08089 ==
−
* common-name:
+
* transcription-direction:
−
** (7z)-tetradecenoyl-coa
+
** negative
−
* smiles:
+
* right-end-position:
−
** ccccccc=ccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** 5147
−
* inchi-key:
+
* left-end-position:
−
** jpihvkickvpffy-twafkmgksa-j
+
** 4527
−
* molecular-weight:
+
* centisome-position:
−
** 971.845
+
** 7.7938848   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[RXN-17792]]
+
* [[S.japonica_sterols_curated]]
−
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
−
* [[RXN-17791]]
+
* [[3.1.26.4-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
−
{{#set: common-name=(7z)-tetradecenoyl-coa}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: inchi-key=inchikey=jpihvkickvpffy-twafkmgksa-j}}
+
* [[DNA-DIRECTED-DNA-POLYMERASE-RXN]]
−
{{#set: molecular-weight=971.845}}
+
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=5147}}
 +
{{#set: left-end-position=4527}}
 +
{{#set: centisome-position=7.7938848    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=3}}

Revision as of 20:20, 18 December 2020

Gene SJ08089

  • transcription-direction:
    • negative
  • right-end-position:
    • 5147
  • left-end-position:
    • 4527
  • centisome-position:
    • 7.7938848

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ11360&oldid=41164"