Difference between revisions of "SJ11423"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CADAVERINE CADAVERINE] == * common-name: ** cadaverine * smiles: ** c([n+])cccc[n+] * inchi-key...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7137 CPD-7137] == * common-name: ** pelargonidin-3,5-di-o-β-d-glucoside * smiles: ** c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7137 CPD-7137] == |
* common-name: | * common-name: | ||
| − | ** | + | ** pelargonidin-3,5-di-o-β-d-glucoside |
* smiles: | * smiles: | ||
| − | ** c([ | + | ** c(o)c5(c(c(c(c(oc3(=cc([o-])=cc2([o+]=c(c1(=cc=c(o)c=c1))c(=cc=23)oc4(c(o)c(o)c(o)c(co)o4))))o5)o)o)o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** slckjkwfulxzbd-zotffytfsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 594.525 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-7828]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=pelargonidin-3,5-di-o-β-d-glucoside}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=slckjkwfulxzbd-zotffytfsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=594.525}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite CPD-7137
- common-name:
- pelargonidin-3,5-di-o-β-d-glucoside
- smiles:
- c(o)c5(c(c(c(c(oc3(=cc([o-])=cc2([o+]=c(c1(=cc=c(o)c=c1))c(=cc=23)oc4(c(o)c(o)c(o)c(co)o4))))o5)o)o)o)
- inchi-key:
- slckjkwfulxzbd-zotffytfsa-n
- molecular-weight:
- 594.525
